C15H16O3 — CID 16737080
(1aS,7S,7aS)-7-hydroxy-1a-(3-methylbut-2-enyl)-7,7a-dihydronaphtho[2,3-b]oxiren-2-one (PubChem CID 16737080) has the molecular formula C15H16O3 and a molecular weight of 244.29 g/mol. Its IUPAC name is (1aS,7S,7aS)-7-hydroxy-1a-(3-methylbut-2-enyl)-7,7a-dihydronaphtho[2,3-b]oxiren-2-one.
| Compound Name | (1aS,7S,7aS)-7-hydroxy-1a-(3-methylbut-2-enyl)-7,7a-dihydronaphtho[2,3-b]oxiren-2-one |
|---|---|
| PubChem CID | 16737080 |
| Molecular Formula | C15H16O3 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.11 |
| IUPAC Name | (1aS,7S,7aS)-7-hydroxy-1a-(3-methylbut-2-enyl)-7,7a-dihydronaphtho[2,3-b]oxiren-2-one |
| SMILES | CC(C)=CC[C@]12O[C@H]1[C@@H](O)c1ccccc1C2=O |
| InChI | InChI=1S/C15H16O3/c1-9(2)7-8-15-13(17)11-6-4-3-5-10(11)12(16)14(15)18-15/h3-7,12,14,16H,8H2,1-2H3/t12-,14-,15+/m0/s1 |
| InChIKey | XOJSFUHFZHGNKT-AEGPPILISA-N |
| XLogP | 2.41 |
| TPSA | 49.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|