C22H18Cl2F3N3O5S — CID 167374330
[2-chloro-3-[2-chloro-3-[5-[(3-hydroxyazetidin-1-yl)methyl]-6-methoxypyrazin-2-yl]phenyl]phenyl] trifluoromethanesulfonate (PubChem CID 167374330) has the molecular formula C22H18Cl2F3N3O5S and a molecular weight of 564.37 g/mol. Its IUPAC name is [2-chloro-3-[2-chloro-3-[5-[(3-hydroxyazetidin-1-yl)methyl]-6-methoxypyrazin-2-yl]phenyl]phenyl] trifluoromethanesulfonate.
| Compound Name | [2-chloro-3-[2-chloro-3-[5-[(3-hydroxyazetidin-1-yl)methyl]-6-methoxypyrazin-2-yl]phenyl]phenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 167374330 |
| Molecular Formula | C22H18Cl2F3N3O5S |
| Molecular Weight | 564.37 g/mol |
| Exact Mass | 563.03 |
| IUPAC Name | [2-chloro-3-[2-chloro-3-[5-[(3-hydroxyazetidin-1-yl)methyl]-6-methoxypyrazin-2-yl]phenyl]phenyl] trifluoromethanesulfonate |
| SMILES | COc1nc(-c2cccc(-c3cccc(OS(=O)(=O)C(F)(F)F)c3Cl)c2Cl)cnc1CN1CC(O)C1 |
| InChI | InChI=1S/C22H18Cl2F3N3O5S/c1-34-21-17(11-30-9-12(31)10-30)28-8-16(29-21)15-6-2-4-13(19(15)23)14-5-3-7-18(20(14)24)35-36(32,33)22(25,26)27/h2-8,12,31H,9-11H2,1H3 |
| InChIKey | ZMWQBUAAVWOWQV-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 101.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.37 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|