C16H17BrClN3O2 — CID 166516806
[1-[[5-(3-bromo-2-chlorophenyl)-3-methoxypyrazin-2-yl]methyl]azetidin-3-yl]methanol (PubChem CID 166516806) has the molecular formula C16H17BrClN3O2 and a molecular weight of 398.69 g/mol. Its IUPAC name is [1-[[5-(3-bromo-2-chlorophenyl)-3-methoxypyrazin-2-yl]methyl]azetidin-3-yl]methanol.
| Compound Name | [1-[[5-(3-bromo-2-chlorophenyl)-3-methoxypyrazin-2-yl]methyl]azetidin-3-yl]methanol |
|---|---|
| PubChem CID | 166516806 |
| Molecular Formula | C16H17BrClN3O2 |
| Molecular Weight | 398.69 g/mol |
| Exact Mass | 397.02 |
| IUPAC Name | [1-[[5-(3-bromo-2-chlorophenyl)-3-methoxypyrazin-2-yl]methyl]azetidin-3-yl]methanol |
| SMILES | COc1nc(-c2cccc(Br)c2Cl)cnc1CN1CC(CO)C1 |
| InChI | InChI=1S/C16H17BrClN3O2/c1-23-16-14(8-21-6-10(7-21)9-22)19-5-13(20-16)11-3-2-4-12(17)15(11)18/h2-5,10,22H,6-9H2,1H3 |
| InChIKey | QIAPXYHDENVEMR-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 58.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.69 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |