C17H21BrClN3O2 — CID 177215260
[5-(3-bromo-2-chlorophenyl)-3-methoxypyrazin-2-yl]methanamine;oxane (PubChem CID 177215260) has the molecular formula C17H21BrClN3O2 and a molecular weight of 414.73 g/mol. Its IUPAC name is [5-(3-bromo-2-chlorophenyl)-3-methoxypyrazin-2-yl]methanamine;oxane.
| Compound Name | [5-(3-bromo-2-chlorophenyl)-3-methoxypyrazin-2-yl]methanamine;oxane |
|---|---|
| PubChem CID | 177215260 |
| Molecular Formula | C17H21BrClN3O2 |
| Molecular Weight | 414.73 g/mol |
| Exact Mass | 413.05 |
| IUPAC Name | [5-(3-bromo-2-chlorophenyl)-3-methoxypyrazin-2-yl]methanamine;oxane |
| SMILES | C1CCOCC1.COc1nc(-c2cccc(Br)c2Cl)cnc1CN |
| InChI | InChI=1S/C12H11BrClN3O.C5H10O/c1-18-12-9(5-15)16-6-10(17-12)7-3-2-4-8(13)11(7)14;1-2-4-6-5-3-1/h2-4,6H,5,15H2,1H3;1-5H2 |
| InChIKey | ZYHYJPKJLMJABZ-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 70.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.73 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |