C19H27N3 — CID 16737638
2-[2,6-dimethyl-1-(3,5,5-trimethylhexyl)-4-pyridinylidene]propanedinitrile (PubChem CID 16737638) has the molecular formula C19H27N3 and a molecular weight of 297.45 g/mol. Its IUPAC name is 2-[2,6-dimethyl-1-(3,5,5-trimethylhexyl)-4-pyridinylidene]propanedinitrile.
| Compound Name | 2-[2,6-dimethyl-1-(3,5,5-trimethylhexyl)-4-pyridinylidene]propanedinitrile |
|---|---|
| PubChem CID | 16737638 |
| Molecular Formula | C19H27N3 |
| Molecular Weight | 297.45 g/mol |
| Exact Mass | 297.22 |
| IUPAC Name | 2-[2,6-dimethyl-1-(3,5,5-trimethylhexyl)-4-pyridinylidene]propanedinitrile |
| SMILES | CC1=CC(=C(C#N)C#N)C=C(C)N1CCC(C)CC(C)(C)C |
| InChI | InChI=1S/C19H27N3/c1-14(11-19(4,5)6)7-8-22-15(2)9-17(10-16(22)3)18(12-20)13-21/h9-10,14H,7-8,11H2,1-6H3 |
| InChIKey | HBDGMKMUKMYMRK-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 50.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.45 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|