C15H19N3 — CID 2307984
2-[2,6-dimethyl-1-(3-methylbutyl)-4-pyridinylidene]propanedinitrile (PubChem CID 2307984) has the molecular formula C15H19N3 and a molecular weight of 241.34 g/mol. Its IUPAC name is 2-[2,6-dimethyl-1-(3-methylbutyl)-4-pyridinylidene]propanedinitrile.
| Compound Name | 2-[2,6-dimethyl-1-(3-methylbutyl)-4-pyridinylidene]propanedinitrile |
|---|---|
| PubChem CID | 2307984 |
| Molecular Formula | C15H19N3 |
| Molecular Weight | 241.34 g/mol |
| Exact Mass | 241.16 |
| IUPAC Name | 2-[2,6-dimethyl-1-(3-methylbutyl)-4-pyridinylidene]propanedinitrile |
| SMILES | CC1=CC(=C(C#N)C#N)C=C(C)N1CCC(C)C |
| InChI | InChI=1S/C15H19N3/c1-11(2)5-6-18-12(3)7-14(8-13(18)4)15(9-16)10-17/h7-8,11H,5-6H2,1-4H3 |
| InChIKey | NXWNDXGJWKADGF-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 50.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.34 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|