C14H17N3 — CID 3516772
2-(1-butyl-2,6-dimethyl-4-pyridinylidene)propanedinitrile (PubChem CID 3516772) has the molecular formula C14H17N3 and a molecular weight of 227.31 g/mol. Its IUPAC name is 2-(1-butyl-2,6-dimethyl-4-pyridinylidene)propanedinitrile.
| Compound Name | 2-(1-butyl-2,6-dimethyl-4-pyridinylidene)propanedinitrile |
|---|---|
| PubChem CID | 3516772 |
| Molecular Formula | C14H17N3 |
| Molecular Weight | 227.31 g/mol |
| Exact Mass | 227.14 |
| IUPAC Name | 2-(1-butyl-2,6-dimethyl-4-pyridinylidene)propanedinitrile |
| SMILES | CCCCN1C(C)=CC(=C(C#N)C#N)C=C1C |
| InChI | InChI=1S/C14H17N3/c1-4-5-6-17-11(2)7-13(8-12(17)3)14(9-15)10-16/h7-8H,4-6H2,1-3H3 |
| InChIKey | UEYVPWAQZUAKLX-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 50.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.31 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|