C14H22N2O — CID 167377264
2,6-ditert-butyl-6,7-dihydrofuro[3,2-d]pyrimidine (PubChem CID 167377264) has the molecular formula C14H22N2O and a molecular weight of 234.34 g/mol. Its IUPAC name is 2,6-ditert-butyl-6,7-dihydrofuro[3,2-d]pyrimidine.
| Compound Name | 2,6-ditert-butyl-6,7-dihydrofuro[3,2-d]pyrimidine |
|---|---|
| PubChem CID | 167377264 |
| Molecular Formula | C14H22N2O |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.17 |
| IUPAC Name | 2,6-ditert-butyl-6,7-dihydrofuro[3,2-d]pyrimidine |
| SMILES | CC(C)(C)c1ncc2c(n1)CC(C(C)(C)C)O2 |
| InChI | InChI=1S/C14H22N2O/c1-13(2,3)11-7-9-10(17-11)8-15-12(16-9)14(4,5)6/h8,11H,7H2,1-6H3 |
| InChIKey | DLRRGLBUPZGXJL-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |