About 2-tert-butyl-6-imino-5,7-dihydrothieno[3,4-d]pyrimidine 6-oxide
2-tert-butyl-6-imino-5,7-dihydrothieno[3,4-d]pyrimidine 6-oxide (PubChem CID 153306204) has the molecular formula C10H15N3OS
and a molecular weight of 225.32 g/mol. Its IUPAC name is 2-tert-butyl-6-imino-5,7-dihydrothieno[3,4-d]pyrimidine 6-oxide.
Analyze 2-tert-butyl-6-imino-5,7-dihydrothieno[3,4-d]pyrimidine 6-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butyl-6-imino-5,7-dihydrothieno[3,4-d]pyrimidine 6-oxide?
The IUPAC name of 2-tert-butyl-6-imino-5,7-dihydrothieno[3,4-d]pyrimidine 6-oxide (CID 153306204) is 2-tert-butyl-6-imino-5,7-dihydrothieno[3,4-d]pyrimidine 6-oxide.
What is the SMILES notation for 2-tert-butyl-6-imino-5,7-dihydrothieno[3,4-d]pyrimidine 6-oxide?
The canonical SMILES for 2-tert-butyl-6-imino-5,7-dihydrothieno[3,4-d]pyrimidine 6-oxide is [H]N=S1(=O)Cc2cnc(C(C)(C)C)nc2C1.
What is the InChIKey of 2-tert-butyl-6-imino-5,7-dihydrothieno[3,4-d]pyrimidine 6-oxide?
The InChIKey is SSTVBHGWNUXGSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N3OS/c1-10(2,3)9-12-4-7-5-15(11,14)6-8(7)13-9/h4,11H,5-6H2,1-3H3.
What are the key properties of 2-tert-butyl-6-imino-5,7-dihydrothieno[3,4-d]pyrimidine 6-oxide?
2-tert-butyl-6-imino-5,7-dihydrothieno[3,4-d]pyrimidine 6-oxide has a molecular weight of 225.32 g/mol, XLogP of 1.83, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butyl-6-imino-5,7-dihydrothieno[3,4-d]pyrimidine 6-oxide is sourced from PubChem (CID 153306204), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).