C45H38N4Si — CID 167382822
dimethyl-[9-[4-(2-phenylphenyl)-2-pyridinyl]carbazol-2-yl]-[3-[3-(trideuteriomethyl)-2H-benzimidazol-1-yl]phenyl]silane (PubChem CID 167382822) has the molecular formula C45H38N4Si and a molecular weight of 665.93 g/mol. Its IUPAC name is dimethyl-[9-[4-(2-phenylphenyl)-2-pyridinyl]carbazol-2-yl]-[3-[3-(trideuteriomethyl)-2H-benzimidazol-1-yl]phenyl]silane.
| Compound Name | dimethyl-[9-[4-(2-phenylphenyl)-2-pyridinyl]carbazol-2-yl]-[3-[3-(trideuteriomethyl)-2H-benzimidazol-1-yl]phenyl]silane |
|---|---|
| PubChem CID | 167382822 |
| Molecular Formula | C45H38N4Si |
| Molecular Weight | 665.93 g/mol |
| Exact Mass | 665.31 |
| IUPAC Name | dimethyl-[9-[4-(2-phenylphenyl)-2-pyridinyl]carbazol-2-yl]-[3-[3-(trideuteriomethyl)-2H-benzimidazol-1-yl]phenyl]silane |
| SMILES | [2H]C([2H])([2H])N1CN(c2cccc([Si](C)(C)c3ccc4c5ccccc5n(-c5cc(-c6ccccc6-c6ccccc6)ccn5)c4c3)c2)c2ccccc21 |
| InChI | InChI=1S/C45H38N4Si/c1-47-31-48(43-23-12-11-22-42(43)47)34-16-13-17-35(29-34)50(2,3)36-24-25-40-39-20-9-10-21-41(39)49(44(40)30-36)45-28-33(26-27-46-45)38-19-8-7-18-37(38)32-14-5-4-6-15-32/h4-30H,31H2,1-3H3/i1D3 |
| InChIKey | DKYZVMAIUCKHMM-FIBGUPNXSA-N |
| XLogP | 9.88 |
| TPSA | 24.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.93 |
| LogP ≤ 5 | 9.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|