C43H42N4Si — CID 167382172
[3-(3-tert-butyl-2H-benzimidazol-1-yl)phenyl]-dimethyl-[9-[4-(2-methylphenyl)-2-pyridinyl]carbazol-2-yl]silane (PubChem CID 167382172) has the molecular formula C43H42N4Si and a molecular weight of 642.92 g/mol. Its IUPAC name is [3-(3-tert-butyl-2H-benzimidazol-1-yl)phenyl]-dimethyl-[9-[4-(2-methylphenyl)-2-pyridinyl]carbazol-2-yl]silane.
| Compound Name | [3-(3-tert-butyl-2H-benzimidazol-1-yl)phenyl]-dimethyl-[9-[4-(2-methylphenyl)-2-pyridinyl]carbazol-2-yl]silane |
|---|---|
| PubChem CID | 167382172 |
| Molecular Formula | C43H42N4Si |
| Molecular Weight | 642.92 g/mol |
| Exact Mass | 642.32 |
| IUPAC Name | [3-(3-tert-butyl-2H-benzimidazol-1-yl)phenyl]-dimethyl-[9-[4-(2-methylphenyl)-2-pyridinyl]carbazol-2-yl]silane |
| SMILES | Cc1ccccc1-c1ccnc(-n2c3ccccc3c3ccc([Si](C)(C)c4cccc(N5CN(C(C)(C)C)c6ccccc65)c4)cc32)c1 |
| InChI | InChI=1S/C43H42N4Si/c1-30-14-7-8-17-35(30)31-24-25-44-42(26-31)47-38-19-10-9-18-36(38)37-23-22-34(28-41(37)47)48(5,6)33-16-13-15-32(27-33)45-29-46(43(2,3)4)40-21-12-11-20-39(40)45/h7-28H,29H2,1-6H3 |
| InChIKey | VQVOCBLNEGJFAM-UHFFFAOYSA-N |
| XLogP | 9.69 |
| TPSA | 24.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.92 |
| LogP ≤ 5 | 9.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|