C13H27N3O4S — CID 167383393
[[1-(4-tert-butylpiperazin-1-yl)-2-methyl-1-oxopropan-2-yl]amino]methanesulfonic acid (PubChem CID 167383393) has the molecular formula C13H27N3O4S and a molecular weight of 321.44 g/mol. Its IUPAC name is [[1-(4-tert-butylpiperazin-1-yl)-2-methyl-1-oxopropan-2-yl]amino]methanesulfonic acid.
| Compound Name | [[1-(4-tert-butylpiperazin-1-yl)-2-methyl-1-oxopropan-2-yl]amino]methanesulfonic acid |
|---|---|
| PubChem CID | 167383393 |
| Molecular Formula | C13H27N3O4S |
| Molecular Weight | 321.44 g/mol |
| Exact Mass | 321.17 |
| IUPAC Name | [[1-(4-tert-butylpiperazin-1-yl)-2-methyl-1-oxopropan-2-yl]amino]methanesulfonic acid |
| SMILES | CC(C)(NCS(=O)(=O)O)C(=O)N1CCN(C(C)(C)C)CC1 |
| InChI | InChI=1S/C13H27N3O4S/c1-12(2,3)16-8-6-15(7-9-16)11(17)13(4,5)14-10-21(18,19)20/h14H,6-10H2,1-5H3,(H,18,19,20) |
| InChIKey | ROOUDQSMOQDSPI-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.44 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|