C7H14N2O3S — CID 63607438
3,3-dimethyl-4-methylsulfonylpiperazin-2-one (PubChem CID 63607438) has the molecular formula C7H14N2O3S and a molecular weight of 206.27 g/mol. Its IUPAC name is 3,3-dimethyl-4-methylsulfonylpiperazin-2-one.
| Compound Name | 3,3-dimethyl-4-methylsulfonylpiperazin-2-one |
|---|---|
| PubChem CID | 63607438 |
| Molecular Formula | C7H14N2O3S |
| Molecular Weight | 206.27 g/mol |
| Exact Mass | 206.07 |
| IUPAC Name | 3,3-dimethyl-4-methylsulfonylpiperazin-2-one |
| SMILES | CC1(C)C(=O)NCCN1S(C)(=O)=O |
| InChI | InChI=1S/C7H14N2O3S/c1-7(2)6(10)8-4-5-9(7)13(3,11)12/h4-5H2,1-3H3,(H,8,10) |
| InChIKey | BLBAURIRROYVDR-UHFFFAOYSA-N |
| XLogP | -0.84 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.27 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |