C7H12F2N2O3S — CID 63600176
4-(difluoromethylsulfonyl)-3-ethylpiperazin-2-one (PubChem CID 63600176) has the molecular formula C7H12F2N2O3S and a molecular weight of 242.25 g/mol. Its IUPAC name is 4-(difluoromethylsulfonyl)-3-ethylpiperazin-2-one.
| Compound Name | 4-(difluoromethylsulfonyl)-3-ethylpiperazin-2-one |
|---|---|
| PubChem CID | 63600176 |
| Molecular Formula | C7H12F2N2O3S |
| Molecular Weight | 242.25 g/mol |
| Exact Mass | 242.05 |
| IUPAC Name | 4-(difluoromethylsulfonyl)-3-ethylpiperazin-2-one |
| SMILES | CCC1C(=O)NCCN1S(=O)(=O)C(F)F |
| InChI | InChI=1S/C7H12F2N2O3S/c1-2-5-6(12)10-3-4-11(5)15(13,14)7(8)9/h5,7H,2-4H2,1H3,(H,10,12) |
| InChIKey | XUHXHYMTPATLGK-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.25 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |