C12H24N3O4S- — CID 167383599
[[2-methyl-1-oxo-1-(4-propan-2-ylpiperazin-1-yl)propan-2-yl]amino]methanesulfonate (PubChem CID 167383599) has the molecular formula C12H24N3O4S- and a molecular weight of 306.41 g/mol. Its IUPAC name is [[2-methyl-1-oxo-1-(4-propan-2-ylpiperazin-1-yl)propan-2-yl]amino]methanesulfonate.
| Compound Name | [[2-methyl-1-oxo-1-(4-propan-2-ylpiperazin-1-yl)propan-2-yl]amino]methanesulfonate |
|---|---|
| PubChem CID | 167383599 |
| Molecular Formula | C12H24N3O4S- |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.15 |
| IUPAC Name | [[2-methyl-1-oxo-1-(4-propan-2-ylpiperazin-1-yl)propan-2-yl]amino]methanesulfonate |
| SMILES | CC(C)N1CCN(C(=O)C(C)(C)NCS(=O)(=O)[O-])CC1 |
| InChI | InChI=1S/C12H25N3O4S/c1-10(2)14-5-7-15(8-6-14)11(16)12(3,4)13-9-20(17,18)19/h10,13H,5-9H2,1-4H3,(H,17,18,19)/p-1 |
| InChIKey | KFJKRZIWYXDZPK-UHFFFAOYSA-M |
| XLogP | -0.59 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|