C25H30F2N7O+ — CID 167386120
aminomethylidene-[7-(difluoromethyl)-1-[3-(methylcarbamoyl)-7-propan-2-yl-1H-pyrrolo[2,3-c]pyridin-5-yl]-3,4-dihydro-2H-quinolin-6-yl]-(methyliminomethyl)azanium (PubChem CID 167386120) has the molecular formula C25H30F2N7O+ and a molecular weight of 482.56 g/mol. Its IUPAC name is aminomethylidene-[7-(difluoromethyl)-1-[3-(methylcarbamoyl)-7-propan-2-yl-1H-pyrrolo[2,3-c]pyridin-5-yl]-3,4-dihydro-2H-quinolin-6-yl]-(methyliminomethyl)azanium.
| Compound Name | aminomethylidene-[7-(difluoromethyl)-1-[3-(methylcarbamoyl)-7-propan-2-yl-1H-pyrrolo[2,3-c]pyridin-5-yl]-3,4-dihydro-2H-quinolin-6-yl]-(methyliminomethyl)azanium |
|---|---|
| PubChem CID | 167386120 |
| Molecular Formula | C25H30F2N7O+ |
| Molecular Weight | 482.56 g/mol |
| Exact Mass | 482.25 |
| IUPAC Name | aminomethylidene-[7-(difluoromethyl)-1-[3-(methylcarbamoyl)-7-propan-2-yl-1H-pyrrolo[2,3-c]pyridin-5-yl]-3,4-dihydro-2H-quinolin-6-yl]-(methyliminomethyl)azanium |
| SMILES | C/N=C/[N+](=C\N)c1cc2c(cc1C(F)F)N(c1cc3c(C(=O)NC)c[nH]c3c(C(C)C)n1)CCC2 |
| InChI | InChI=1S/C25H29F2N7O/c1-14(2)22-23-16(18(11-31-23)25(35)30-4)10-21(32-22)34-7-5-6-15-8-20(33(12-28)13-29-3)17(24(26)27)9-19(15)34/h8-14,24,28H,5-7H2,1-4H3,(H2,30,31,32,35)/p+1/b29-13+ |
| InChIKey | WZJUTYVRWMTQNN-VFLNYLIXSA-O |
| XLogP | 4.36 |
| TPSA | 102.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.56 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|