C21H26F2N6 — CID 177190847
(Z)-2-[7-(difluoromethyl)-1-(5-methyl-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-3-yl)-3,4-dihydro-2H-quinolin-6-yl]-3-methyliminoprop-1-en-1-amine (PubChem CID 177190847) has the molecular formula C21H26F2N6 and a molecular weight of 400.48 g/mol. Its IUPAC name is (Z)-2-[7-(difluoromethyl)-1-(5-methyl-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-3-yl)-3,4-dihydro-2H-quinolin-6-yl]-3-methyliminoprop-1-en-1-amine.
| Compound Name | (Z)-2-[7-(difluoromethyl)-1-(5-methyl-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-3-yl)-3,4-dihydro-2H-quinolin-6-yl]-3-methyliminoprop-1-en-1-amine |
|---|---|
| PubChem CID | 177190847 |
| Molecular Formula | C21H26F2N6 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.22 |
| IUPAC Name | (Z)-2-[7-(difluoromethyl)-1-(5-methyl-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-3-yl)-3,4-dihydro-2H-quinolin-6-yl]-3-methyliminoprop-1-en-1-amine |
| SMILES | C/N=C/C(=C\N)c1cc2c(cc1C(F)F)N(c1n[nH]c3c1CN(C)CC3)CCC2 |
| InChI | InChI=1S/C21H26F2N6/c1-25-11-14(10-24)15-8-13-4-3-6-29(19(13)9-16(15)20(22)23)21-17-12-28(2)7-5-18(17)26-27-21/h8-11,20H,3-7,12,24H2,1-2H3,(H,26,27)/b14-10+,25-11+ |
| InChIKey | NZRYXCAEVKBIQX-USCHKXCLSA-N |
| XLogP | 3.42 |
| TPSA | 73.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|