C25H43N3O — CID 167386719
1-[3-[(3R)-1-(2-methylpropyl)pyrrolidin-3-yl]oxypropyl]-4-[(4-propan-2-ylphenyl)methyl]piperazine (PubChem CID 167386719) has the molecular formula C25H43N3O and a molecular weight of 401.64 g/mol. Its IUPAC name is 1-[3-[(3R)-1-(2-methylpropyl)pyrrolidin-3-yl]oxypropyl]-4-[(4-propan-2-ylphenyl)methyl]piperazine.
| Compound Name | 1-[3-[(3R)-1-(2-methylpropyl)pyrrolidin-3-yl]oxypropyl]-4-[(4-propan-2-ylphenyl)methyl]piperazine |
|---|---|
| PubChem CID | 167386719 |
| Molecular Formula | C25H43N3O |
| Molecular Weight | 401.64 g/mol |
| Exact Mass | 401.34 |
| IUPAC Name | 1-[3-[(3R)-1-(2-methylpropyl)pyrrolidin-3-yl]oxypropyl]-4-[(4-propan-2-ylphenyl)methyl]piperazine |
| SMILES | CC(C)CN1CC[C@@H](OCCCN2CCN(Cc3ccc(C(C)C)cc3)CC2)C1 |
| InChI | InChI=1S/C25H43N3O/c1-21(2)18-28-12-10-25(20-28)29-17-5-11-26-13-15-27(16-14-26)19-23-6-8-24(9-7-23)22(3)4/h6-9,21-22,25H,5,10-20H2,1-4H3/t25-/m1/s1 |
| InChIKey | RBBGLTXOEWNJEM-RUZDIDTESA-N |
| XLogP | 4.06 |
| TPSA | 18.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.64 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|