C24H41N3O — CID 167386772
1-[3-[1-(2-methylpropyl)azetidin-3-yl]oxypropyl]-4-[(4-propan-2-ylphenyl)methyl]piperazine (PubChem CID 167386772) has the molecular formula C24H41N3O and a molecular weight of 387.61 g/mol. Its IUPAC name is 1-[3-[1-(2-methylpropyl)azetidin-3-yl]oxypropyl]-4-[(4-propan-2-ylphenyl)methyl]piperazine.
| Compound Name | 1-[3-[1-(2-methylpropyl)azetidin-3-yl]oxypropyl]-4-[(4-propan-2-ylphenyl)methyl]piperazine |
|---|---|
| PubChem CID | 167386772 |
| Molecular Formula | C24H41N3O |
| Molecular Weight | 387.61 g/mol |
| Exact Mass | 387.32 |
| IUPAC Name | 1-[3-[1-(2-methylpropyl)azetidin-3-yl]oxypropyl]-4-[(4-propan-2-ylphenyl)methyl]piperazine |
| SMILES | CC(C)CN1CC(OCCCN2CCN(Cc3ccc(C(C)C)cc3)CC2)C1 |
| InChI | InChI=1S/C24H41N3O/c1-20(2)16-27-18-24(19-27)28-15-5-10-25-11-13-26(14-12-25)17-22-6-8-23(9-7-22)21(3)4/h6-9,20-21,24H,5,10-19H2,1-4H3 |
| InChIKey | GLNPEDPVVZRXTK-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 18.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.61 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|