C24H32N2O8 — CID 16738730
2-(9-oxoacridin-10-yl)acetic acid;(2R,3S,4R,5S)-6-(propylamino)hexane-1,2,3,4,5-pentol (PubChem CID 16738730) has the molecular formula C24H32N2O8 and a molecular weight of 476.53 g/mol. Its IUPAC name is 2-(9-oxoacridin-10-yl)acetic acid;(2R,3S,4R,5S)-6-(propylamino)hexane-1,2,3,4,5-pentol.
| Compound Name | 2-(9-oxoacridin-10-yl)acetic acid;(2R,3S,4R,5S)-6-(propylamino)hexane-1,2,3,4,5-pentol |
|---|---|
| PubChem CID | 16738730 |
| Molecular Formula | C24H32N2O8 |
| Molecular Weight | 476.53 g/mol |
| Exact Mass | 476.22 |
| IUPAC Name | 2-(9-oxoacridin-10-yl)acetic acid;(2R,3S,4R,5S)-6-(propylamino)hexane-1,2,3,4,5-pentol |
| SMILES | CCCNC[C@H](O)[C@@H](O)[C@@H](O)[C@H](O)CO.O=C(O)Cn1c2ccccc2c(=O)c2ccccc21 |
| InChI | InChI=1S/C15H11NO3.C9H21NO5/c17-14(18)9-16-12-7-3-1-5-10(12)15(19)11-6-2-4-8-13(11)16;1-2-3-10-4-6(12)8(14)9(15)7(13)5-11/h1-8H,9H2,(H,17,18);6-15H,2-5H2,1H3/t;6-,7+,8+,9-/m.0/s1 |
| InChIKey | ZXTGHNGIOLSKKN-OCDUBUJGSA-N |
| XLogP | -0.34 |
| TPSA | 172.48 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.53 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|