C47H92N2O6S — CID 167389132
nonyl 8-[3-(cyclopropylsulfonylamino)propyl-(8-hexadecan-8-yloxy-8-oxooctyl)amino]octanoate (PubChem CID 167389132) has the molecular formula C47H92N2O6S and a molecular weight of 813.33 g/mol. Its IUPAC name is nonyl 8-[3-(cyclopropylsulfonylamino)propyl-(8-hexadecan-8-yloxy-8-oxooctyl)amino]octanoate.
| Compound Name | nonyl 8-[3-(cyclopropylsulfonylamino)propyl-(8-hexadecan-8-yloxy-8-oxooctyl)amino]octanoate |
|---|---|
| PubChem CID | 167389132 |
| Molecular Formula | C47H92N2O6S |
| Molecular Weight | 813.33 g/mol |
| Exact Mass | 812.67 |
| IUPAC Name | nonyl 8-[3-(cyclopropylsulfonylamino)propyl-(8-hexadecan-8-yloxy-8-oxooctyl)amino]octanoate |
| SMILES | CCCCCCCCCOC(=O)CCCCCCCN(CCCCCCCC(=O)OC(CCCCCCC)CCCCCCCC)CCCNS(=O)(=O)C1CC1 |
| InChI | InChI=1S/C47H92N2O6S/c1-4-7-10-13-15-24-31-43-54-46(50)35-27-20-16-22-29-40-49(42-32-39-48-56(52,53)45-37-38-45)41-30-23-17-21-28-36-47(51)55-44(33-25-18-12-9-6-3)34-26-19-14-11-8-5-2/h44-45,48H,4-43H2,1-3H3 |
| InChIKey | YPVJFOFADYZSKK-UHFFFAOYSA-N |
| XLogP | 12.76 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 44 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 813.33 |
| LogP ≤ 5 | 12.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|