C8H11BrN4 — CID 167390654
N,N'-diamino-4-bromo-N-methylbenzenecarboximidamide (PubChem CID 167390654) has the molecular formula C8H11BrN4 and a molecular weight of 243.11 g/mol. Its IUPAC name is N,N'-diamino-4-bromo-N-methylbenzenecarboximidamide.
| Compound Name | N,N'-diamino-4-bromo-N-methylbenzenecarboximidamide |
|---|---|
| PubChem CID | 167390654 |
| Molecular Formula | C8H11BrN4 |
| Molecular Weight | 243.11 g/mol |
| Exact Mass | 242.02 |
| IUPAC Name | N,N'-diamino-4-bromo-N-methylbenzenecarboximidamide |
| SMILES | CN(N)/C(=N\N)c1ccc(Br)cc1 |
| InChI | InChI=1S/C8H11BrN4/c1-13(11)8(12-10)6-2-4-7(9)5-3-6/h2-5H,10-11H2,1H3/b12-8- |
| InChIKey | IDMAOAWBQGAVDA-WQLSENKSSA-N |
| XLogP | 0.87 |
| TPSA | 67.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.11 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|