C57H64N2O — CID 167390714
3-N-(3-tert-butylphenyl)-3-N-dibenzofuran-4-yl-5-methyl-1-N,1-N-bis(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)benzene-1,3-diamine (PubChem CID 167390714) has the molecular formula C57H64N2O and a molecular weight of 793.15 g/mol. Its IUPAC name is 3-N-(3-tert-butylphenyl)-3-N-dibenzofuran-4-yl-5-methyl-1-N,1-N-bis(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)benzene-1,3-diamine.
| Compound Name | 3-N-(3-tert-butylphenyl)-3-N-dibenzofuran-4-yl-5-methyl-1-N,1-N-bis(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)benzene-1,3-diamine |
|---|---|
| PubChem CID | 167390714 |
| Molecular Formula | C57H64N2O |
| Molecular Weight | 793.15 g/mol |
| Exact Mass | 792.50 |
| IUPAC Name | 3-N-(3-tert-butylphenyl)-3-N-dibenzofuran-4-yl-5-methyl-1-N,1-N-bis(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)benzene-1,3-diamine |
| SMILES | Cc1cc(N(c2ccc3c(c2)C(C)(C)CCC3(C)C)c2ccc3c(c2)C(C)(C)CCC3(C)C)cc(N(c2cccc(C(C)(C)C)c2)c2cccc3c2oc2ccccc23)c1 |
| InChI | InChI=1S/C57H64N2O/c1-37-31-42(34-43(32-37)59(39-18-15-17-38(33-39)53(2,3)4)50-21-16-20-45-44-19-13-14-22-51(44)60-52(45)50)58(40-23-25-46-48(35-40)56(9,10)29-27-54(46,5)6)41-24-26-47-49(36-41)57(11,12)30-28-55(47,7)8/h13-26,31-36H,27-30H2,1-12H3 |
| InChIKey | LADCHUPAFICLFU-UHFFFAOYSA-N |
| XLogP | 16.83 |
| TPSA | 19.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 793.15 |
| LogP ≤ 5 | 16.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |