C57H68N2 — CID 166497789
1-N,1-N-bis(4-tert-butylphenyl)-3-N-(4-tert-butyl-2-phenylphenyl)-5-methyl-3-N-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)benzene-1,3-diamine (PubChem CID 166497789) has the molecular formula C57H68N2 and a molecular weight of 781.19 g/mol. Its IUPAC name is 1-N,1-N-bis(4-tert-butylphenyl)-3-N-(4-tert-butyl-2-phenylphenyl)-5-methyl-3-N-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)benzene-1,3-diamine.
| Compound Name | 1-N,1-N-bis(4-tert-butylphenyl)-3-N-(4-tert-butyl-2-phenylphenyl)-5-methyl-3-N-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)benzene-1,3-diamine |
|---|---|
| PubChem CID | 166497789 |
| Molecular Formula | C57H68N2 |
| Molecular Weight | 781.19 g/mol |
| Exact Mass | 780.54 |
| IUPAC Name | 1-N,1-N-bis(4-tert-butylphenyl)-3-N-(4-tert-butyl-2-phenylphenyl)-5-methyl-3-N-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)benzene-1,3-diamine |
| SMILES | Cc1cc(N(c2ccc(C(C)(C)C)cc2)c2ccc(C(C)(C)C)cc2)cc(N(c2ccc3c(c2)C(C)(C)CCC3(C)C)c2ccc(C(C)(C)C)cc2-c2ccccc2)c1 |
| InChI | InChI=1S/C57H68N2/c1-39-34-47(58(44-25-20-41(21-26-44)53(2,3)4)45-27-22-42(23-28-45)54(5,6)7)37-48(35-39)59(46-29-30-50-51(38-46)57(13,14)33-32-56(50,11)12)52-31-24-43(55(8,9)10)36-49(52)40-18-16-15-17-19-40/h15-31,34-38H,32-33H2,1-14H3 |
| InChIKey | MDYDYUZYCRKWFP-UHFFFAOYSA-N |
| XLogP | 16.84 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 781.19 |
| LogP ≤ 5 | 16.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |