C57H70N2O — CID 167384249
1-N,1-N-bis(4-tert-butylphenyl)-3-N-(4-tert-butyl-2-phenylphenyl)-5-propan-2-yl-3-N-(4,4,7,7-tetramethyl-5,6-dihydro-1-benzofuran-3-yl)benzene-1,3-diamine (PubChem CID 167384249) has the molecular formula C57H70N2O and a molecular weight of 799.20 g/mol. Its IUPAC name is 1-N,1-N-bis(4-tert-butylphenyl)-3-N-(4-tert-butyl-2-phenylphenyl)-5-propan-2-yl-3-N-(4,4,7,7-tetramethyl-5,6-dihydro-1-benzofuran-3-yl)benzene-1,3-diamine.
| Compound Name | 1-N,1-N-bis(4-tert-butylphenyl)-3-N-(4-tert-butyl-2-phenylphenyl)-5-propan-2-yl-3-N-(4,4,7,7-tetramethyl-5,6-dihydro-1-benzofuran-3-yl)benzene-1,3-diamine |
|---|---|
| PubChem CID | 167384249 |
| Molecular Formula | C57H70N2O |
| Molecular Weight | 799.20 g/mol |
| Exact Mass | 798.55 |
| IUPAC Name | 1-N,1-N-bis(4-tert-butylphenyl)-3-N-(4-tert-butyl-2-phenylphenyl)-5-propan-2-yl-3-N-(4,4,7,7-tetramethyl-5,6-dihydro-1-benzofuran-3-yl)benzene-1,3-diamine |
| SMILES | CC(C)c1cc(N(c2ccc(C(C)(C)C)cc2)c2ccc(C(C)(C)C)cc2)cc(N(c2ccc(C(C)(C)C)cc2-c2ccccc2)c2coc3c2C(C)(C)CCC3(C)C)c1 |
| InChI | InChI=1S/C57H70N2O/c1-38(2)40-33-46(58(44-26-21-41(22-27-44)53(3,4)5)45-28-23-42(24-29-45)54(6,7)8)36-47(34-40)59(50-37-60-52-51(50)56(12,13)31-32-57(52,14)15)49-30-25-43(55(9,10)11)35-48(49)39-19-17-16-18-20-39/h16-30,33-38H,31-32H2,1-15H3 |
| InChIKey | VCYMTTXYGSFJAG-UHFFFAOYSA-N |
| XLogP | 17.25 |
| TPSA | 19.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 799.20 |
| LogP ≤ 5 | 17.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |