C23H23ClN4O — CID 16739511
(16E)-11-chloro-14-methyl-20-oxa-5,7,14,27-tetrazatetracyclo[19.3.1.12,6.18,12]heptacosa-1(25),2(27),3,5,8(26),9,11,16,21,23-decaene (PubChem CID 16739511) has the molecular formula C23H23ClN4O and a molecular weight of 406.92 g/mol. Its IUPAC name is (16E)-11-chloro-14-methyl-20-oxa-5,7,14,27-tetrazatetracyclo[19.3.1.12,6.18,12]heptacosa-1(25),2(27),3,5,8(26),9,11,16,21,23-decaene.
| Compound Name | (16E)-11-chloro-14-methyl-20-oxa-5,7,14,27-tetrazatetracyclo[19.3.1.12,6.18,12]heptacosa-1(25),2(27),3,5,8(26),9,11,16,21,23-decaene |
|---|---|
| PubChem CID | 16739511 |
| Molecular Formula | C23H23ClN4O |
| Molecular Weight | 406.92 g/mol |
| Exact Mass | 406.16 |
| IUPAC Name | (16E)-11-chloro-14-methyl-20-oxa-5,7,14,27-tetrazatetracyclo[19.3.1.12,6.18,12]heptacosa-1(25),2(27),3,5,8(26),9,11,16,21,23-decaene |
| SMILES | CN1C/C=C\CCOc2cccc(c2)-c2ccnc(n2)Nc2ccc(Cl)c(c2)C1 |
| InChI | InChI=1S/C23H23ClN4O/c1-28-12-3-2-4-13-29-20-7-5-6-17(15-20)22-10-11-25-23(27-22)26-19-8-9-21(24)18(14-19)16-28/h2-3,5-11,14-15H,4,12-13,16H2,1H3,(H,25,26,27)/b3-2- |
| InChIKey | VQNXOAVFMIVTAT-IHWYPQMZSA-N |
| XLogP | 5.31 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.92 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|