C22H23BrN4O4S — CID 16739566
ethyl 2-[7-[(3-bromophenyl)methyl]-3-methyl-2,6-dioxo-1-prop-2-ynylpurin-8-yl]sulfanylbutanoate (PubChem CID 16739566) has the molecular formula C22H23BrN4O4S and a molecular weight of 519.42 g/mol. Its IUPAC name is ethyl 2-[7-[(3-bromophenyl)methyl]-3-methyl-2,6-dioxo-1-prop-2-ynylpurin-8-yl]sulfanylbutanoate.
| Compound Name | ethyl 2-[7-[(3-bromophenyl)methyl]-3-methyl-2,6-dioxo-1-prop-2-ynylpurin-8-yl]sulfanylbutanoate |
|---|---|
| PubChem CID | 16739566 |
| Molecular Formula | C22H23BrN4O4S |
| Molecular Weight | 519.42 g/mol |
| Exact Mass | 518.06 |
| IUPAC Name | ethyl 2-[7-[(3-bromophenyl)methyl]-3-methyl-2,6-dioxo-1-prop-2-ynylpurin-8-yl]sulfanylbutanoate |
| SMILES | C#CCn1c(=O)c2c(nc(SC(CC)C(=O)OCC)n2Cc2cccc(Br)c2)n(C)c1=O |
| InChI | InChI=1S/C22H23BrN4O4S/c1-5-11-26-19(28)17-18(25(4)22(26)30)24-21(32-16(6-2)20(29)31-7-3)27(17)13-14-9-8-10-15(23)12-14/h1,8-10,12,16H,6-7,11,13H2,2-4H3 |
| InChIKey | IFVASJYLGFLPIS-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 88.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.42 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|