C29H32F4N2O10S — CID 167398003
4-[5-[[(1R,2S,3R,5R)-2,3-dihydroxy-5-[[3-(trifluoromethylsulfonyl)phenyl]carbamoyl]cyclopentyl]carbamoyl]-2-fluoro-4-methoxyphenoxy]-1-methylcyclohexane-1-carboxylic acid (PubChem CID 167398003) has the molecular formula C29H32F4N2O10S and a molecular weight of 676.64 g/mol. Its IUPAC name is 4-[5-[[(1R,2S,3R,5R)-2,3-dihydroxy-5-[[3-(trifluoromethylsulfonyl)phenyl]carbamoyl]cyclopentyl]carbamoyl]-2-fluoro-4-methoxyphenoxy]-1-methylcyclohexane-1-carboxylic acid.
| Compound Name | 4-[5-[[(1R,2S,3R,5R)-2,3-dihydroxy-5-[[3-(trifluoromethylsulfonyl)phenyl]carbamoyl]cyclopentyl]carbamoyl]-2-fluoro-4-methoxyphenoxy]-1-methylcyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 167398003 |
| Molecular Formula | C29H32F4N2O10S |
| Molecular Weight | 676.64 g/mol |
| Exact Mass | 676.17 |
| IUPAC Name | 4-[5-[[(1R,2S,3R,5R)-2,3-dihydroxy-5-[[3-(trifluoromethylsulfonyl)phenyl]carbamoyl]cyclopentyl]carbamoyl]-2-fluoro-4-methoxyphenoxy]-1-methylcyclohexane-1-carboxylic acid |
| SMILES | COc1cc(F)c(OC2CCC(C)(C(=O)O)CC2)cc1C(=O)N[C@H]1[C@H](O)[C@H](O)C[C@H]1C(=O)Nc1cccc(S(=O)(=O)C(F)(F)F)c1 |
| InChI | InChI=1S/C29H32F4N2O10S/c1-28(27(40)41)8-6-15(7-9-28)45-22-12-17(21(44-2)13-19(22)30)25(38)35-23-18(11-20(36)24(23)37)26(39)34-14-4-3-5-16(10-14)46(42,43)29(31,32)33/h3-5,10,12-13,15,18,20,23-24,36-37H,6-9,11H2,1-2H3,(H,34,39)(H,35,38)(H,40,41)/t15?,18-,20-,23-,24-,28?/m1/s1 |
| InChIKey | UXHGDJAZQZLBPW-BKXJHMBMSA-N |
| XLogP | 3.02 |
| TPSA | 188.56 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.64 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |