C46H37N4O+ — CID 167399438
CID 167399438 (PubChem CID 167399438) has the molecular formula C46H37N4O+ and a molecular weight of 661.83 g/mol.
| Compound Name | CID 167399438 |
|---|---|
| PubChem CID | 167399438 |
| Molecular Formula | C46H37N4O+ |
| Molecular Weight | 661.83 g/mol |
| Exact Mass | 661.30 |
| IUPAC Name | — |
| SMILES | Cc1cc(Oc2cc(-c3ccccc3)c3c4ccccc4n(-c4ccccn4)c3c2)cc([N@@+]23[CH-][N@@+](c4ccccc4)(C2)c2cc(C)c(C)cc23)c1 |
| InChI | InChI=1S/C46H37N4O/c1-31-22-36(50-29-49(30-50,35-16-8-5-9-17-35)43-24-32(2)33(3)25-44(43)50)26-37(23-31)51-38-27-40(34-14-6-4-7-15-34)46-39-18-10-11-19-41(39)48(42(46)28-38)45-20-12-13-21-47-45/h4-29H,30H2,1-3H3/q+1/t49-,50+/m0/s1 |
| InChIKey | MXANYNWDNSDRSN-LOYCUKJKSA-N |
| XLogP | 11.95 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.83 |
| LogP ≤ 5 | 11.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|