C56H50N4 — CID 167399455
2-[diphenyl-[3-[3-(trideuteriomethyl)-2H-benzimidazol-1-yl]phenyl]methyl]-9-[4-[2,6-di(propan-2-yl)phenyl]-2-pyridinyl]carbazole (PubChem CID 167399455) has the molecular formula C56H50N4 and a molecular weight of 782.06 g/mol. Its IUPAC name is 2-[diphenyl-[3-[3-(trideuteriomethyl)-2H-benzimidazol-1-yl]phenyl]methyl]-9-[4-[2,6-di(propan-2-yl)phenyl]-2-pyridinyl]carbazole.
| Compound Name | 2-[diphenyl-[3-[3-(trideuteriomethyl)-2H-benzimidazol-1-yl]phenyl]methyl]-9-[4-[2,6-di(propan-2-yl)phenyl]-2-pyridinyl]carbazole |
|---|---|
| PubChem CID | 167399455 |
| Molecular Formula | C56H50N4 |
| Molecular Weight | 782.06 g/mol |
| Exact Mass | 781.42 |
| IUPAC Name | 2-[diphenyl-[3-[3-(trideuteriomethyl)-2H-benzimidazol-1-yl]phenyl]methyl]-9-[4-[2,6-di(propan-2-yl)phenyl]-2-pyridinyl]carbazole |
| SMILES | [2H]C([2H])([2H])N1CN(c2cccc(C(c3ccccc3)(c3ccccc3)c3ccc4c5ccccc5n(-c5cc(-c6c(C(C)C)cccc6C(C)C)ccn5)c4c3)c2)c2ccccc21 |
| InChI | InChI=1S/C56H50N4/c1-38(2)46-25-17-26-47(39(3)4)55(46)40-32-33-57-54(34-40)60-50-27-13-12-24-48(50)49-31-30-44(36-53(49)60)56(41-18-8-6-9-19-41,42-20-10-7-11-21-42)43-22-16-23-45(35-43)59-37-58(5)51-28-14-15-29-52(51)59/h6-36,38-39H,37H2,1-5H3/i5D3 |
| InChIKey | KRIITFSNSCVYRD-VPYROQPTSA-N |
| XLogP | 14.02 |
| TPSA | 24.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 782.06 |
| LogP ≤ 5 | 14.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|