C65H60N4 — CID 169055773
2-[[3-[3-(3-tert-butylphenyl)-2H-benzimidazol-1-yl]phenyl]-diphenylmethyl]-9-[4-[2,6-di(propan-2-yl)phenyl]-2-pyridinyl]carbazole (PubChem CID 169055773) has the molecular formula C65H60N4 and a molecular weight of 897.22 g/mol. Its IUPAC name is 2-[[3-[3-(3-tert-butylphenyl)-2H-benzimidazol-1-yl]phenyl]-diphenylmethyl]-9-[4-[2,6-di(propan-2-yl)phenyl]-2-pyridinyl]carbazole.
| Compound Name | 2-[[3-[3-(3-tert-butylphenyl)-2H-benzimidazol-1-yl]phenyl]-diphenylmethyl]-9-[4-[2,6-di(propan-2-yl)phenyl]-2-pyridinyl]carbazole |
|---|---|
| PubChem CID | 169055773 |
| Molecular Formula | C65H60N4 |
| Molecular Weight | 897.22 g/mol |
| Exact Mass | 896.48 |
| IUPAC Name | 2-[[3-[3-(3-tert-butylphenyl)-2H-benzimidazol-1-yl]phenyl]-diphenylmethyl]-9-[4-[2,6-di(propan-2-yl)phenyl]-2-pyridinyl]carbazole |
| SMILES | CC(C)c1cccc(C(C)C)c1-c1ccnc(-n2c3ccccc3c3ccc(C(c4ccccc4)(c4ccccc4)c4cccc(N5CN(c6cccc(C(C)(C)C)c6)c6ccccc65)c4)cc32)c1 |
| InChI | InChI=1S/C65H60N4/c1-44(2)54-30-20-31-55(45(3)4)63(54)46-37-38-66-62(39-46)69-58-32-15-14-29-56(58)57-36-35-51(42-61(57)69)65(47-21-10-8-11-22-47,48-23-12-9-13-24-48)50-26-19-28-53(41-50)68-43-67(59-33-16-17-34-60(59)68)52-27-18-25-49(40-52)64(5,6)7/h8-42,44-45H,43H2,1-7H3 |
| InChIKey | DMTGYCSNOBJWOP-UHFFFAOYSA-N |
| XLogP | 17.02 |
| TPSA | 24.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 897.22 |
| LogP ≤ 5 | 17.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|