C63H44N4S — CID 167401608
12-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)-2-[4-[(1E,3Z)-hexa-1,3,5-trienyl]phenyl]-6-(4-phenylcyclohexa-2,4-dien-1-yl)phenyl]-[1]benzothiolo[2,3-a]carbazole (PubChem CID 167401608) has the molecular formula C63H44N4S and a molecular weight of 889.14 g/mol. Its IUPAC name is 12-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)-2-[4-[(1E,3Z)-hexa-1,3,5-trienyl]phenyl]-6-(4-phenylcyclohexa-2,4-dien-1-yl)phenyl]-[1]benzothiolo[2,3-a]carbazole.
| Compound Name | 12-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)-2-[4-[(1E,3Z)-hexa-1,3,5-trienyl]phenyl]-6-(4-phenylcyclohexa-2,4-dien-1-yl)phenyl]-[1]benzothiolo[2,3-a]carbazole |
|---|---|
| PubChem CID | 167401608 |
| Molecular Formula | C63H44N4S |
| Molecular Weight | 889.14 g/mol |
| Exact Mass | 888.33 |
| IUPAC Name | 12-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)-2-[4-[(1E,3Z)-hexa-1,3,5-trienyl]phenyl]-6-(4-phenylcyclohexa-2,4-dien-1-yl)phenyl]-[1]benzothiolo[2,3-a]carbazole |
| SMILES | C=C/C=C\C=C\c1ccc(-c2cc(-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)cc(C3C=CC(c4ccccc4)=CC3)c2-n2c3ccccc3c3ccc4c5ccccc5sc4c32)cc1 |
| InChI | InChI=1S/C63H44N4S/c1-2-3-4-8-19-42-30-32-45(33-31-42)54-40-49(63-65-61(47-22-11-6-12-23-47)64-62(66-63)48-24-13-7-14-25-48)41-55(46-36-34-44(35-37-46)43-20-9-5-10-21-43)58(54)67-56-28-17-15-26-50(56)52-38-39-53-51-27-16-18-29-57(51)68-60(53)59(52)67/h2-36,38-41,46H,1,37H2/b4-3-,19-8+ |
| InChIKey | JCBCRORQLIBANT-DQTJUKQTSA-N |
| XLogP | 16.89 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 889.14 |
| LogP ≤ 5 | 16.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|