C63H42N4S — CID 168748007
12-[4-[4-[(1E,3Z)-hexa-1,3,5-trienyl]-6-phenyl-1,3,5-triazin-2-yl]-2,6-bis(4-phenylphenyl)phenyl]-[1]benzothiolo[2,3-a]carbazole (PubChem CID 168748007) has the molecular formula C63H42N4S and a molecular weight of 887.12 g/mol. Its IUPAC name is 12-[4-[4-[(1E,3Z)-hexa-1,3,5-trienyl]-6-phenyl-1,3,5-triazin-2-yl]-2,6-bis(4-phenylphenyl)phenyl]-[1]benzothiolo[2,3-a]carbazole.
| Compound Name | 12-[4-[4-[(1E,3Z)-hexa-1,3,5-trienyl]-6-phenyl-1,3,5-triazin-2-yl]-2,6-bis(4-phenylphenyl)phenyl]-[1]benzothiolo[2,3-a]carbazole |
|---|---|
| PubChem CID | 168748007 |
| Molecular Formula | C63H42N4S |
| Molecular Weight | 887.12 g/mol |
| Exact Mass | 886.31 |
| IUPAC Name | 12-[4-[4-[(1E,3Z)-hexa-1,3,5-trienyl]-6-phenyl-1,3,5-triazin-2-yl]-2,6-bis(4-phenylphenyl)phenyl]-[1]benzothiolo[2,3-a]carbazole |
| SMILES | C=C/C=C\C=C\c1nc(-c2ccccc2)nc(-c2cc(-c3ccc(-c4ccccc4)cc3)c(-n3c4ccccc4c4ccc5c6ccccc6sc5c43)c(-c3ccc(-c4ccccc4)cc3)c2)n1 |
| InChI | InChI=1S/C63H42N4S/c1-2-3-4-14-29-58-64-62(48-23-12-7-13-24-48)66-63(65-58)49-40-54(46-34-30-44(31-35-46)42-19-8-5-9-20-42)59(55(41-49)47-36-32-45(33-37-47)43-21-10-6-11-22-43)67-56-27-17-15-25-50(56)52-38-39-53-51-26-16-18-28-57(51)68-61(53)60(52)67/h2-41H,1H2/b4-3-,29-14+ |
| InChIKey | AQYDDKQCUQXQRB-FGHCORORSA-N |
| XLogP | 17.09 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 887.12 |
| LogP ≤ 5 | 17.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|