C17H13N3O3 — CID 16740256
N-[(E)-2-cyano-3-(2-hydroxyanilino)prop-2-enoyl]benzamide (PubChem CID 16740256) has the molecular formula C17H13N3O3 and a molecular weight of 307.31 g/mol. Its IUPAC name is N-[(E)-2-cyano-3-(2-hydroxyanilino)prop-2-enoyl]benzamide.
| Compound Name | N-[(E)-2-cyano-3-(2-hydroxyanilino)prop-2-enoyl]benzamide |
|---|---|
| PubChem CID | 16740256 |
| Molecular Formula | C17H13N3O3 |
| Molecular Weight | 307.31 g/mol |
| Exact Mass | 307.10 |
| IUPAC Name | N-[(E)-2-cyano-3-(2-hydroxyanilino)prop-2-enoyl]benzamide |
| SMILES | N#C/C(=C\Nc1ccccc1O)C(=O)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C17H13N3O3/c18-10-13(11-19-14-8-4-5-9-15(14)21)17(23)20-16(22)12-6-2-1-3-7-12/h1-9,11,19,21H,(H,20,22,23)/b13-11+ |
| InChIKey | VERNPCIZZQLMEC-ACCUITESSA-N |
| XLogP | 2.17 |
| TPSA | 102.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.31 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyano_ene_amine_C(3)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|