C52H33N5O — CID 167403636
9-[4-(4-dibenzofuran-3-yl-2-phenyl-1,2-dihydro-1,3,5-triazin-6-yl)-2,6-diphenylphenyl]-3-isocyanocarbazole (PubChem CID 167403636) has the molecular formula C52H33N5O and a molecular weight of 743.87 g/mol. Its IUPAC name is 9-[4-(4-dibenzofuran-3-yl-2-phenyl-1,2-dihydro-1,3,5-triazin-6-yl)-2,6-diphenylphenyl]-3-isocyanocarbazole.
| Compound Name | 9-[4-(4-dibenzofuran-3-yl-2-phenyl-1,2-dihydro-1,3,5-triazin-6-yl)-2,6-diphenylphenyl]-3-isocyanocarbazole |
|---|---|
| PubChem CID | 167403636 |
| Molecular Formula | C52H33N5O |
| Molecular Weight | 743.87 g/mol |
| Exact Mass | 743.27 |
| IUPAC Name | 9-[4-(4-dibenzofuran-3-yl-2-phenyl-1,2-dihydro-1,3,5-triazin-6-yl)-2,6-diphenylphenyl]-3-isocyanocarbazole |
| SMILES | [C-]#[N+]c1ccc2c(c1)c1ccccc1n2-c1c(-c2ccccc2)cc(C2=NC(c3ccc4c(c3)oc3ccccc34)=NC(c3ccccc3)N2)cc1-c1ccccc1 |
| InChI | InChI=1S/C52H33N5O/c1-53-38-26-28-46-44(32-38)39-21-11-13-23-45(39)57(46)49-42(33-15-5-2-6-16-33)29-37(30-43(49)34-17-7-3-8-18-34)52-55-50(35-19-9-4-10-20-35)54-51(56-52)36-25-27-41-40-22-12-14-24-47(40)58-48(41)31-36/h2-32,50H,(H,54,55,56) |
| InChIKey | BFPWRQAVAXNQDG-UHFFFAOYSA-N |
| XLogP | 13.06 |
| TPSA | 59.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 743.87 |
| LogP ≤ 5 | 13.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|