C22H24BrN3O2 — CID 167403828
3-[[6-bromo-4-[2-(dimethylamino)ethyl]-1-oxoisoquinolin-2-yl]methyl]-N-methylbenzamide (PubChem CID 167403828) has the molecular formula C22H24BrN3O2 and a molecular weight of 442.36 g/mol. Its IUPAC name is 3-[[6-bromo-4-[2-(dimethylamino)ethyl]-1-oxoisoquinolin-2-yl]methyl]-N-methylbenzamide.
| Compound Name | 3-[[6-bromo-4-[2-(dimethylamino)ethyl]-1-oxoisoquinolin-2-yl]methyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 167403828 |
| Molecular Formula | C22H24BrN3O2 |
| Molecular Weight | 442.36 g/mol |
| Exact Mass | 441.11 |
| IUPAC Name | 3-[[6-bromo-4-[2-(dimethylamino)ethyl]-1-oxoisoquinolin-2-yl]methyl]-N-methylbenzamide |
| SMILES | CNC(=O)c1cccc(Cn2cc(CCN(C)C)c3cc(Br)ccc3c2=O)c1 |
| InChI | InChI=1S/C22H24BrN3O2/c1-24-21(27)16-6-4-5-15(11-16)13-26-14-17(9-10-25(2)3)20-12-18(23)7-8-19(20)22(26)28/h4-8,11-12,14H,9-10,13H2,1-3H3,(H,24,27) |
| InChIKey | NSPGBSICGYZNEI-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 54.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.36 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |