C26H28N2O4 — CID 167420174
phenyl 7-cyclopentyloxy-2-(1-methyl-2-oxabicyclo[2.2.1]heptan-4-yl)imidazo[1,2-a]pyridine-6-carboxylate (PubChem CID 167420174) has the molecular formula C26H28N2O4 and a molecular weight of 432.52 g/mol. Its IUPAC name is phenyl 7-cyclopentyloxy-2-(1-methyl-2-oxabicyclo[2.2.1]heptan-4-yl)imidazo[1,2-a]pyridine-6-carboxylate.
| Compound Name | phenyl 7-cyclopentyloxy-2-(1-methyl-2-oxabicyclo[2.2.1]heptan-4-yl)imidazo[1,2-a]pyridine-6-carboxylate |
|---|---|
| PubChem CID | 167420174 |
| Molecular Formula | C26H28N2O4 |
| Molecular Weight | 432.52 g/mol |
| Exact Mass | 432.20 |
| IUPAC Name | phenyl 7-cyclopentyloxy-2-(1-methyl-2-oxabicyclo[2.2.1]heptan-4-yl)imidazo[1,2-a]pyridine-6-carboxylate |
| SMILES | CC12CCC(c3cn4cc(C(=O)Oc5ccccc5)c(OC5CCCC5)cc4n3)(CO1)C2 |
| InChI | InChI=1S/C26H28N2O4/c1-25-11-12-26(16-25,17-30-25)22-15-28-14-20(24(29)32-19-7-3-2-4-8-19)21(13-23(28)27-22)31-18-9-5-6-10-18/h2-4,7-8,13-15,18H,5-6,9-12,16-17H2,1H3 |
| InChIKey | DPGORTCJBVILDU-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 62.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.52 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|