C46H44N4O8 — CID 175737272
phenyl 7-cyclopropyloxy-2-(1-methyl-2-oxabicyclo[2.1.1]hexan-4-yl)imidazo[1,2-a]pyridine-6-carboxylate (PubChem CID 175737272) has the molecular formula C46H44N4O8 and a molecular weight of 780.88 g/mol. Its IUPAC name is phenyl 7-cyclopropyloxy-2-(1-methyl-2-oxabicyclo[2.1.1]hexan-4-yl)imidazo[1,2-a]pyridine-6-carboxylate.
| Compound Name | phenyl 7-cyclopropyloxy-2-(1-methyl-2-oxabicyclo[2.1.1]hexan-4-yl)imidazo[1,2-a]pyridine-6-carboxylate |
|---|---|
| PubChem CID | 175737272 |
| Molecular Formula | C46H44N4O8 |
| Molecular Weight | 780.88 g/mol |
| Exact Mass | 780.32 |
| IUPAC Name | phenyl 7-cyclopropyloxy-2-(1-methyl-2-oxabicyclo[2.1.1]hexan-4-yl)imidazo[1,2-a]pyridine-6-carboxylate |
| SMILES | CC12CC(c3cn4cc(C(=O)Oc5ccccc5)c(OC5CC5)cc4n3)(CO1)C2.CC12CC(c3cn4cc(C(=O)Oc5ccccc5)c(OC5CC5)cc4n3)(CO1)C2 |
| InChI | InChI=1S/2C23H22N2O4/c2*1-22-12-23(13-22,14-27-22)19-11-25-10-17(21(26)29-15-5-3-2-4-6-15)18(9-20(25)24-19)28-16-7-8-16/h2*2-6,9-11,16H,7-8,12-14H2,1H3 |
| InChIKey | ATINODVROSLREX-UHFFFAOYSA-N |
| XLogP | 7.83 |
| TPSA | 124.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 58 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 780.88 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|