C11H7BrF3NO2 — CID 167420919
6-(2-bromoacetyl)-4-(trifluoromethyl)-2,3-dihydroisoindol-1-one (PubChem CID 167420919) has the molecular formula C11H7BrF3NO2 and a molecular weight of 322.08 g/mol. Its IUPAC name is 6-(2-bromoacetyl)-4-(trifluoromethyl)-2,3-dihydroisoindol-1-one.
| Compound Name | 6-(2-bromoacetyl)-4-(trifluoromethyl)-2,3-dihydroisoindol-1-one |
|---|---|
| PubChem CID | 167420919 |
| Molecular Formula | C11H7BrF3NO2 |
| Molecular Weight | 322.08 g/mol |
| Exact Mass | 320.96 |
| IUPAC Name | 6-(2-bromoacetyl)-4-(trifluoromethyl)-2,3-dihydroisoindol-1-one |
| SMILES | O=C(CBr)c1cc2c(c(C(F)(F)F)c1)CNC2=O |
| InChI | InChI=1S/C11H7BrF3NO2/c12-3-9(17)5-1-6-7(4-16-10(6)18)8(2-5)11(13,14)15/h1-2H,3-4H2,(H,16,18) |
| InChIKey | IYQGVSALLXWELV-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.08 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|