C9H9BrFN3OS — CID 167421120
1-[(2-bromo-5-fluorobenzoyl)amino]-3-methylthiourea (PubChem CID 167421120) has the molecular formula C9H9BrFN3OS and a molecular weight of 306.16 g/mol. Its IUPAC name is 1-[(2-bromo-5-fluorobenzoyl)amino]-3-methylthiourea.
| Compound Name | 1-[(2-bromo-5-fluorobenzoyl)amino]-3-methylthiourea |
|---|---|
| PubChem CID | 167421120 |
| Molecular Formula | C9H9BrFN3OS |
| Molecular Weight | 306.16 g/mol |
| Exact Mass | 304.96 |
| IUPAC Name | 1-[(2-bromo-5-fluorobenzoyl)amino]-3-methylthiourea |
| SMILES | CNC(=S)NNC(=O)c1cc(F)ccc1Br |
| InChI | InChI=1S/C9H9BrFN3OS/c1-12-9(16)14-13-8(15)6-4-5(11)2-3-7(6)10/h2-4H,1H3,(H,13,15)(H2,12,14,16) |
| InChIKey | TWYZWDXGWSFSNB-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.16 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|