C12H11FN4O2S — CID 71517101
1-[(6-fluoro-4-oxo-1H-quinoline-2-carbonyl)amino]-3-methylthiourea (PubChem CID 71517101) has the molecular formula C12H11FN4O2S and a molecular weight of 294.31 g/mol. Its IUPAC name is 1-[(6-fluoro-4-oxo-1H-quinoline-2-carbonyl)amino]-3-methylthiourea.
| Compound Name | 1-[(6-fluoro-4-oxo-1H-quinoline-2-carbonyl)amino]-3-methylthiourea |
|---|---|
| PubChem CID | 71517101 |
| Molecular Formula | C12H11FN4O2S |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.06 |
| IUPAC Name | 1-[(6-fluoro-4-oxo-1H-quinoline-2-carbonyl)amino]-3-methylthiourea |
| SMILES | CNC(=S)NNC(=O)c1cc(=O)c2cc(F)ccc2[nH]1 |
| InChI | InChI=1S/C12H11FN4O2S/c1-14-12(20)17-16-11(19)9-5-10(18)7-4-6(13)2-3-8(7)15-9/h2-5H,1H3,(H,15,18)(H,16,19)(H2,14,17,20) |
| InChIKey | OCHPAYAPUOQLKE-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 86.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|