C23H20ClFN10O — CID 167421334
5-[3-chloro-2-fluoro-6-(tetrazol-1-yl)phenyl]-2-[2-cyclopropyl-1-[4-(3-methyltriazol-4-yl)pyrazol-1-yl]ethyl]-1-oxidopyridin-1-ium (PubChem CID 167421334) has the molecular formula C23H20ClFN10O and a molecular weight of 506.93 g/mol. Its IUPAC name is 5-[3-chloro-2-fluoro-6-(tetrazol-1-yl)phenyl]-2-[2-cyclopropyl-1-[4-(3-methyltriazol-4-yl)pyrazol-1-yl]ethyl]-1-oxidopyridin-1-ium.
| Compound Name | 5-[3-chloro-2-fluoro-6-(tetrazol-1-yl)phenyl]-2-[2-cyclopropyl-1-[4-(3-methyltriazol-4-yl)pyrazol-1-yl]ethyl]-1-oxidopyridin-1-ium |
|---|---|
| PubChem CID | 167421334 |
| Molecular Formula | C23H20ClFN10O |
| Molecular Weight | 506.93 g/mol |
| Exact Mass | 506.15 |
| IUPAC Name | 5-[3-chloro-2-fluoro-6-(tetrazol-1-yl)phenyl]-2-[2-cyclopropyl-1-[4-(3-methyltriazol-4-yl)pyrazol-1-yl]ethyl]-1-oxidopyridin-1-ium |
| SMILES | Cn1nncc1-c1cnn(C(CC2CC2)c2ccc(-c3c(-n4cnnn4)ccc(Cl)c3F)c[n+]2[O-])c1 |
| InChI | InChI=1S/C23H20ClFN10O/c1-32-21(10-26-30-32)16-9-28-33(11-16)20(8-14-2-3-14)18-6-4-15(12-35(18)36)22-19(34-13-27-29-31-34)7-5-17(24)23(22)25/h4-7,9-14,20H,2-3,8H2,1H3 |
| InChIKey | UEPSOPOFJCIMBO-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 119.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.93 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|