C25H19ClF2N8O — CID 167421466
5-[3-chloro-2-fluoro-6-(tetrazol-1-yl)phenyl]-2-[(1S)-2-cyclopropyl-1-[4-(2-fluoro-4-pyridinyl)pyrazol-1-yl]ethyl]-1-oxidopyridin-1-ium (PubChem CID 167421466) has the molecular formula C25H19ClF2N8O and a molecular weight of 520.93 g/mol. Its IUPAC name is 5-[3-chloro-2-fluoro-6-(tetrazol-1-yl)phenyl]-2-[(1S)-2-cyclopropyl-1-[4-(2-fluoro-4-pyridinyl)pyrazol-1-yl]ethyl]-1-oxidopyridin-1-ium.
| Compound Name | 5-[3-chloro-2-fluoro-6-(tetrazol-1-yl)phenyl]-2-[(1S)-2-cyclopropyl-1-[4-(2-fluoro-4-pyridinyl)pyrazol-1-yl]ethyl]-1-oxidopyridin-1-ium |
|---|---|
| PubChem CID | 167421466 |
| Molecular Formula | C25H19ClF2N8O |
| Molecular Weight | 520.93 g/mol |
| Exact Mass | 520.13 |
| IUPAC Name | 5-[3-chloro-2-fluoro-6-(tetrazol-1-yl)phenyl]-2-[(1S)-2-cyclopropyl-1-[4-(2-fluoro-4-pyridinyl)pyrazol-1-yl]ethyl]-1-oxidopyridin-1-ium |
| SMILES | [O-][n+]1cc(-c2c(-n3cnnn3)ccc(Cl)c2F)ccc1[C@H](CC1CC1)n1cc(-c2ccnc(F)c2)cn1 |
| InChI | InChI=1S/C25H19ClF2N8O/c26-19-4-6-21(35-14-30-32-33-35)24(25(19)28)17-3-5-20(36(37)13-17)22(9-15-1-2-15)34-12-18(11-31-34)16-7-8-29-23(27)10-16/h3-8,10-15,22H,1-2,9H2/t22-/m0/s1 |
| InChIKey | PWLOQMPICIOZNA-QFIPXVFZSA-N |
| XLogP | 4.54 |
| TPSA | 101.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.93 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|