C14H15FN2O2 — CID 167421559
tert-butyl 3-fluoro-4-(1H-pyrazol-4-yl)benzoate (PubChem CID 167421559) has the molecular formula C14H15FN2O2 and a molecular weight of 262.28 g/mol. Its IUPAC name is tert-butyl 3-fluoro-4-(1H-pyrazol-4-yl)benzoate.
| Compound Name | tert-butyl 3-fluoro-4-(1H-pyrazol-4-yl)benzoate |
|---|---|
| PubChem CID | 167421559 |
| Molecular Formula | C14H15FN2O2 |
| Molecular Weight | 262.28 g/mol |
| Exact Mass | 262.11 |
| IUPAC Name | tert-butyl 3-fluoro-4-(1H-pyrazol-4-yl)benzoate |
| SMILES | CC(C)(C)OC(=O)c1ccc(-c2cn[nH]c2)c(F)c1 |
| InChI | InChI=1S/C14H15FN2O2/c1-14(2,3)19-13(18)9-4-5-11(12(15)6-9)10-7-16-17-8-10/h4-8H,1-3H3,(H,16,17) |
| InChIKey | RZCVHRNKSQFERL-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.28 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |