About tert-butyl 1H-pyrazole-4-carboxylate;methane
tert-butyl 1H-pyrazole-4-carboxylate;methane (PubChem CID 166118225) has the molecular formula C9H16N2O2
and a molecular weight of 184.24 g/mol. Its IUPAC name is tert-butyl 1H-pyrazole-4-carboxylate;methane.
Molecular Properties
| Compound Name | tert-butyl 1H-pyrazole-4-carboxylate;methane |
| PubChem CID | 166118225 |
| Molecular Formula | C9H16N2O2 |
| Molecular Weight | 184.24 g/mol |
| Exact Mass | 184.12 |
| IUPAC Name | tert-butyl 1H-pyrazole-4-carboxylate;methane |
| SMILES | C.CC(C)(C)OC(=O)c1cn[nH]c1 |
| InChI | InChI=1S/C8H12N2O2.CH4/c1-8(2,3)12-7(11)6-4-9-10-5-6;/h4-5H,1-3H3,(H,9,10);1H4 |
| InChIKey | KYCIQRXGTQIAMX-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.24 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze tert-butyl 1H-pyrazole-4-carboxylate;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 1H-pyrazole-4-carboxylate;methane?
The IUPAC name of tert-butyl 1H-pyrazole-4-carboxylate;methane (CID 166118225) is tert-butyl 1H-pyrazole-4-carboxylate;methane.
What is the SMILES notation for tert-butyl 1H-pyrazole-4-carboxylate;methane?
The canonical SMILES for tert-butyl 1H-pyrazole-4-carboxylate;methane is C.CC(C)(C)OC(=O)c1cn[nH]c1.
What is the InChIKey of tert-butyl 1H-pyrazole-4-carboxylate;methane?
The InChIKey is KYCIQRXGTQIAMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2O2.CH4/c1-8(2,3)12-7(11)6-4-9-10-5-6;/h4-5H,1-3H3,(H,9,10);1H4.
What are the key properties of tert-butyl 1H-pyrazole-4-carboxylate;methane?
tert-butyl 1H-pyrazole-4-carboxylate;methane has a molecular weight of 184.24 g/mol, XLogP of 2.00, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 1H-pyrazole-4-carboxylate;methane is sourced from PubChem (CID 166118225), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).