C6H10N4O2 — CID 153327676
2,2-diaminoethyl 1H-pyrazole-4-carboxylate (PubChem CID 153327676) has the molecular formula C6H10N4O2 and a molecular weight of 170.17 g/mol. Its IUPAC name is 2,2-diaminoethyl 1H-pyrazole-4-carboxylate.
| Compound Name | 2,2-diaminoethyl 1H-pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 153327676 |
| Molecular Formula | C6H10N4O2 |
| Molecular Weight | 170.17 g/mol |
| Exact Mass | 170.08 |
| IUPAC Name | 2,2-diaminoethyl 1H-pyrazole-4-carboxylate |
| SMILES | NC(N)COC(=O)c1cn[nH]c1 |
| InChI | InChI=1S/C6H10N4O2/c7-5(8)3-12-6(11)4-1-9-10-2-4/h1-2,5H,3,7-8H2,(H,9,10) |
| InChIKey | XHYULGBLKCGQKG-UHFFFAOYSA-N |
| XLogP | -1.19 |
| TPSA | 107.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.17 |
| LogP ≤ 5 | -1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|