About ethyl 1H-pyrazole-4-carboxylate;molecular hydrogen
ethyl 1H-pyrazole-4-carboxylate;molecular hydrogen (PubChem CID 164534260) has the molecular formula C6H10N2O2
and a molecular weight of 142.16 g/mol. Its IUPAC name is ethyl 1H-pyrazole-4-carboxylate;molecular hydrogen.
Molecular Properties
| Compound Name | ethyl 1H-pyrazole-4-carboxylate;molecular hydrogen |
| PubChem CID | 164534260 |
| Molecular Formula | C6H10N2O2 |
| Molecular Weight | 142.16 g/mol |
| Exact Mass | 142.07 |
| IUPAC Name | ethyl 1H-pyrazole-4-carboxylate;molecular hydrogen |
| SMILES | CCOC(=O)c1cn[nH]c1.[H][H] |
| InChI | InChI=1S/C6H8N2O2.H2/c1-2-10-6(9)5-3-7-8-4-5;/h3-4H,2H2,1H3,(H,7,8);1H |
| InChIKey | XZAAPZOVTVEEPD-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.16 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethyl 1H-pyrazole-4-carboxylate;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 1H-pyrazole-4-carboxylate;molecular hydrogen?
The IUPAC name of ethyl 1H-pyrazole-4-carboxylate;molecular hydrogen (CID 164534260) is ethyl 1H-pyrazole-4-carboxylate;molecular hydrogen.
What is the SMILES notation for ethyl 1H-pyrazole-4-carboxylate;molecular hydrogen?
The canonical SMILES for ethyl 1H-pyrazole-4-carboxylate;molecular hydrogen is CCOC(=O)c1cn[nH]c1.[H][H].
What is the InChIKey of ethyl 1H-pyrazole-4-carboxylate;molecular hydrogen?
The InChIKey is XZAAPZOVTVEEPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2O2.H2/c1-2-10-6(9)5-3-7-8-4-5;/h3-4H,2H2,1H3,(H,7,8);1H.
What are the key properties of ethyl 1H-pyrazole-4-carboxylate;molecular hydrogen?
ethyl 1H-pyrazole-4-carboxylate;molecular hydrogen has a molecular weight of 142.16 g/mol, XLogP of 0.83, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 1H-pyrazole-4-carboxylate;molecular hydrogen is sourced from PubChem (CID 164534260), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).