C8H14O5S2 — CID 167424394
1,3-bis(ethenylsulfonyl)-1-methoxypropane (PubChem CID 167424394) has the molecular formula C8H14O5S2 and a molecular weight of 254.33 g/mol. Its IUPAC name is 1,3-bis(ethenylsulfonyl)-1-methoxypropane.
| Compound Name | 1,3-bis(ethenylsulfonyl)-1-methoxypropane |
|---|---|
| PubChem CID | 167424394 |
| Molecular Formula | C8H14O5S2 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.03 |
| IUPAC Name | 1,3-bis(ethenylsulfonyl)-1-methoxypropane |
| SMILES | C=CS(=O)(=O)CCC(OC)S(=O)(=O)C=C |
| InChI | InChI=1S/C8H14O5S2/c1-4-14(9,10)7-6-8(13-3)15(11,12)5-2/h4-5,8H,1-2,6-7H2,3H3 |
| InChIKey | ZPVIOOXWFMWPKY-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |