C26H34F3N5O5 — CID 167424997
3-[(1S)-1-cyano-2-[(5S)-2,2-dimethyl-4-oxo-1,3-oxazolidin-5-yl]ethyl]-4-[(2S)-3,3-dimethyl-2-[(2,2,2-trifluoroacetyl)amino]butanoyl]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3-carboxamide (PubChem CID 167424997) has the molecular formula C26H34F3N5O5 and a molecular weight of 553.58 g/mol. Its IUPAC name is 3-[(1S)-1-cyano-2-[(5S)-2,2-dimethyl-4-oxo-1,3-oxazolidin-5-yl]ethyl]-4-[(2S)-3,3-dimethyl-2-[(2,2,2-trifluoroacetyl)amino]butanoyl]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3-carboxamide.
| Compound Name | 3-[(1S)-1-cyano-2-[(5S)-2,2-dimethyl-4-oxo-1,3-oxazolidin-5-yl]ethyl]-4-[(2S)-3,3-dimethyl-2-[(2,2,2-trifluoroacetyl)amino]butanoyl]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3-carboxamide |
|---|---|
| PubChem CID | 167424997 |
| Molecular Formula | C26H34F3N5O5 |
| Molecular Weight | 553.58 g/mol |
| Exact Mass | 553.25 |
| IUPAC Name | 3-[(1S)-1-cyano-2-[(5S)-2,2-dimethyl-4-oxo-1,3-oxazolidin-5-yl]ethyl]-4-[(2S)-3,3-dimethyl-2-[(2,2,2-trifluoroacetyl)amino]butanoyl]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3-carboxamide |
| SMILES | CC1(C)NC(=O)[C@H](C[C@H](C#N)C2(C(N)=O)C3C4C=CC(C4)C3CN2C(=O)[C@@H](NC(=O)C(F)(F)F)C(C)(C)C)O1 |
| InChI | InChI=1S/C26H34F3N5O5/c1-23(2,3)18(32-22(38)26(27,28)29)20(36)34-11-15-12-6-7-13(8-12)17(15)25(34,21(31)37)14(10-30)9-16-19(35)33-24(4,5)39-16/h6-7,12-18H,8-9,11H2,1-5H3,(H2,31,37)(H,32,38)(H,33,35)/t12?,13?,14-,15?,16+,17?,18-,25?/m1/s1 |
| InChIKey | MWGVUUYNNQXVGI-QSNBLEQSSA-N |
| XLogP | 1.37 |
| TPSA | 154.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.58 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|