C25H32F3N5O4 — CID 167424830
3-[(1S)-1-cyano-2-[(3S)-2-oxopyrrolidin-3-yl]ethyl]-4-[(2S)-3,3-dimethyl-2-[(2,2,2-trifluoroacetyl)amino]butanoyl]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3-carboxamide (PubChem CID 167424830) has the molecular formula C25H32F3N5O4 and a molecular weight of 523.56 g/mol. Its IUPAC name is 3-[(1S)-1-cyano-2-[(3S)-2-oxopyrrolidin-3-yl]ethyl]-4-[(2S)-3,3-dimethyl-2-[(2,2,2-trifluoroacetyl)amino]butanoyl]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3-carboxamide.
| Compound Name | 3-[(1S)-1-cyano-2-[(3S)-2-oxopyrrolidin-3-yl]ethyl]-4-[(2S)-3,3-dimethyl-2-[(2,2,2-trifluoroacetyl)amino]butanoyl]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3-carboxamide |
|---|---|
| PubChem CID | 167424830 |
| Molecular Formula | C25H32F3N5O4 |
| Molecular Weight | 523.56 g/mol |
| Exact Mass | 523.24 |
| IUPAC Name | 3-[(1S)-1-cyano-2-[(3S)-2-oxopyrrolidin-3-yl]ethyl]-4-[(2S)-3,3-dimethyl-2-[(2,2,2-trifluoroacetyl)amino]butanoyl]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3-carboxamide |
| SMILES | CC(C)(C)[C@H](NC(=O)C(F)(F)F)C(=O)N1CC2C3C=CC(C3)C2C1(C(N)=O)[C@@H](C#N)C[C@H]1CCNC1=O |
| InChI | InChI=1S/C25H32F3N5O4/c1-23(2,3)18(32-22(37)25(26,27)28)20(35)33-11-16-12-4-5-13(8-12)17(16)24(33,21(30)36)15(10-29)9-14-6-7-31-19(14)34/h4-5,12-18H,6-9,11H2,1-3H3,(H2,30,36)(H,31,34)(H,32,37)/t12?,13?,14-,15-,16?,17?,18-,24?/m1/s1 |
| InChIKey | RLBWKTLKLNGIML-ABYTYMNGSA-N |
| XLogP | 1.25 |
| TPSA | 145.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.56 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|